Jump to content

Evoxine: Difference between revisions

Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
No edit summary
Added bibcode.
 
(23 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{drugbox
{{
| Watchedfields = changed
| verifiedrevid = 414055854
| verifiedrevid =
⚫
| IUPAC_name = 1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbutane-2,3-diol
| image = Evoxine.png
| = Evoxine.
| ImageAlt =
| width = 200
⚫
| = 1-(4,8-[2,3-b]quinolin-7-yl)oxy-3-methylbutane-2,3-diol
⚫
| CAS_number = 522-11-2
| OtherNames = Haploperine
| ATC_prefix = none
|Section1={{Chembox Identifiers
| ATC_suffix =
⚫
| = 522-11-2
| PubChem = 73416
| PubChem = 73416
| DrugBank =
| ChEMBL = 1416006
| C=11|H=12|O=2
⚫
| = CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O
| molecular_weight = 347.362 g/mol
| ChemSpiderID = 66130
⚫
| smiles = CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O
| InChI = 1/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3
| bioavailability =
| InChIKey = FGANMDNHTVJAHL-UHFFFAOYAV
| protein_bound =
| StdInChI = 1S/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3
| metabolism =
| StdInChIKey = FGANMDNHTVJAHL-UHFFFAOYSA-N}}
| elimination_half-life =
|Section2={{Chembox Properties
| excretion =
| C=18 | H=21 | N=1 | O=6
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| Appearance =
| pregnancy_US = <!-- A / B / C / D / X -->
| Density =
| pregnancy_category=
| MeltingPt =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| BoilingPt =
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| Solubility = }}
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
|Section3={{Chembox Hazards
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| MainHazards =
| legal_status = Legal
| FlashPt =
| routes_of_administration =
| AutoignitionPt = }}
|Section5={{Chembox Pharmacology
| ATCCode_prefix = none

| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
}}
}}
}}


'''Evoxine''' ('''Haploperine''') is an [[alkaloid]] with [[hypnotic]] and [[sedative]] effects. It is found naturally in a variety of Australian and African plants including ''[[Evodia xanthoxyloides]]''<ref>{{cite journal | doi = 10.1071/CH9540087 | last1 = Eastwood | first1 = FW | last2 = Hughes | first2 = GK | last3 = Ritchie | first3 = E. | year = 1954 | title = Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine | url = | journal = Australian Journal of Chemistry | volume = 7 | issue = 1| pages = 87–98 }}</ref> and ''[[Teclea gerrardii]]''.<ref>{{cite journal | last1 = Waffo | first1 = AF | last2 = Coombes | first2 = PH | last3 = Crouch | first3 = NR | last4 = Mulholland | first4 = DA | last5 = El Amin | first5 = SM | last6 = Smith | first6 = PJ | title = Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa. | journal = Phytochemistry | volume = 68 | issue = 5 | pages = 663–7 | year = 2007 | pmid = 17174364 | doi = 10.1016/j.phytochem.2006.10.011 }}</ref>
'''Evoxine''' ('''''') is [[alkaloid]] with [[hypnotic]] and [[sedative]] effects. It is found naturally in a variety of Australian and African plants including ''[[Evodia xanthoxyloides]]''<ref>{{cite journal | doi = 10.1071/CH9540087 | last1 = Eastwood | first1 = FW | last2 = Hughes | first2 = GK | last3 = Ritchie | first3 = E. | year = 1954 | title = Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine | journal = Australian Journal of Chemistry | volume = 7 | issue = 1| pages = 87–98 }}</ref> and ''[[Teclea gerrardii]]''.<ref>{{cite journal | last1 = Waffo | first1 = AF | last2 = Coombes | first2 = PH | last3 = Crouch | first3 = NR | last4 = Mulholland | first4 = DA | last5 = El Amin | first5 = SM | last6 = Smith | first6 = PJ | title = Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa. | journal = Phytochemistry | volume = 68 | issue = 5 | pages = 663–7 | year = 2007 | pmid = 17174364 | doi = 10.1016/j.phytochem.2006.10.011 }}</ref>


==References==
==References==
Line 37: Line 55:
[[Category:Hypnotics]]
[[Category:Hypnotics]]
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]
[[Category:Diols]]
[[Category:]]
[[Category:Furans]]
[[Category:]]
[[Category:Quinolines]]
[[Category:]]
[[Category:Heterocyclic compounds with 3 rings]]
[[ar:إيفوكسين]]




Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"